C6H13ClO6 — CID 118497193
(2S,3S,4R,5R)-1-chlorohexane-1,2,3,4,5,6-hexol (PubChem CID 118497193) has the molecular formula C6H13ClO6 and a molecular weight of 216.62 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-chlorohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5R)-1-chlorohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 118497193 |
| Molecular Formula | C6H13ClO6 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (2S,3S,4R,5R)-1-chlorohexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)Cl |
| InChI | InChI=1S/C6H13ClO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-6,8-13H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | WWCMKOONCCZFPC-QTVWNMPRSA-N |
| XLogP | -3.02 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|