C11H21NO7 — CID 174365508
methyl 4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butanoate (PubChem CID 174365508) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butanoate.
| Compound Name | methyl 4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butanoate |
|---|---|
| PubChem CID | 174365508 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 4-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]butanoate |
| SMILES | COC(=O)CCCN[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H21NO7/c1-18-7(14)3-2-4-12-8-10(16)9(15)6(5-13)19-11(8)17/h6,8-13,15-17H,2-5H2,1H3/t6-,8-,9-,10-,11?/m1/s1 |
| InChIKey | IRSAPYJORUXHAY-FFLVSVRWSA-N |
| XLogP | -2.67 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|