C13H18O8S — CID 15714967
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzenesulfonate (PubChem CID 15714967) has the molecular formula C13H18O8S and a molecular weight of 334.35 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzenesulfonate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzenesulfonate |
|---|---|
| PubChem CID | 15714967 |
| Molecular Formula | C13H18O8S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzenesulfonate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O8S/c1-19-13-12(11(16)10(15)9(7-14)20-13)21-22(17,18)8-5-3-2-4-6-8/h2-6,9-16H,7H2,1H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | DVSHVLIKWWQVFE-LBELIVKGSA-N |
| XLogP | -1.15 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|