C15H16F6O8S — CID 71485693
[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 71485693) has the molecular formula C15H16F6O8S and a molecular weight of 470.34 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71485693 |
| Molecular Formula | C15H16F6O8S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H]1O |
| InChI | InChI=1S/C15H16F6O8S/c1-27-13-11(24)12(10(23)9(5-22)28-13)29-30(25,26)8-3-6(14(16,17)18)2-7(4-8)15(19,20)21/h2-4,9-13,22-24H,5H2,1H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | ILLYZHHJBBIOQK-RXGFPQBGSA-N |
| XLogP | 0.88 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|