C25H29Cl6NO11S2 — CID 44606264
[(2R,3S,4R,5R,6S)-6-methoxy-3,4-bis(phenylmethoxy)-5-(2,2,2-trichloroethoxysulfonylamino)oxan-2-yl]methyl 2,2,2-trichloroethyl sulfate (PubChem CID 44606264) has the molecular formula C25H29Cl6NO11S2 and a molecular weight of 796.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-methoxy-3,4-bis(phenylmethoxy)-5-(2,2,2-trichloroethoxysulfonylamino)oxan-2-yl]methyl 2,2,2-trichloroethyl sulfate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-methoxy-3,4-bis(phenylmethoxy)-5-(2,2,2-trichloroethoxysulfonylamino)oxan-2-yl]methyl 2,2,2-trichloroethyl sulfate |
|---|---|
| PubChem CID | 44606264 |
| Molecular Formula | C25H29Cl6NO11S2 |
| Molecular Weight | 796.35 g/mol |
| Exact Mass | 792.93 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-methoxy-3,4-bis(phenylmethoxy)-5-(2,2,2-trichloroethoxysulfonylamino)oxan-2-yl]methyl 2,2,2-trichloroethyl sulfate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)OCC(Cl)(Cl)Cl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NS(=O)(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H29Cl6NO11S2/c1-37-23-20(32-44(33,34)41-15-24(26,27)28)22(39-13-18-10-6-3-7-11-18)21(38-12-17-8-4-2-5-9-17)19(43-23)14-40-45(35,36)42-16-25(29,30)31/h2-11,19-23,32H,12-16H2,1H3/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | HCMRYBGLSIDRJJ-JLMDMGSGSA-N |
| XLogP | 4.77 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|