C29H32F3NO7S — CID 24770624
1,1,1-trifluoro-N-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]methanesulfonamide (PubChem CID 24770624) has the molecular formula C29H32F3NO7S and a molecular weight of 595.64 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 24770624 |
| Molecular Formula | C29H32F3NO7S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 1,1,1-trifluoro-N-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]methanesulfonamide |
| SMILES | CO[C@H]1O[C@H](CNS(=O)(=O)C(F)(F)F)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32F3NO7S/c1-36-28-27(39-20-23-15-9-4-10-16-23)26(38-19-22-13-7-3-8-14-22)25(37-18-21-11-5-2-6-12-21)24(40-28)17-33-41(34,35)29(30,31)32/h2-16,24-28,33H,17-20H2,1H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | AYNZUYWCGXXXEJ-DFLSAPQXSA-N |
| XLogP | 4.55 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |