C22H24N2O5 — CID 45050154
N-[(8aS)-6,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxazin-7-yl]benzamide (PubChem CID 45050154) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[(8aS)-6,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxazin-7-yl]benzamide.
| Compound Name | N-[(8aS)-6,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxazin-7-yl]benzamide |
|---|---|
| PubChem CID | 45050154 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[(8aS)-6,8-dimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[2,3-e][1,3]oxazin-7-yl]benzamide |
| SMILES | COC1OC2CN=C(c3ccccc3)O[C@@H]2C(OC)C1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O5/c1-26-19-17(24-20(25)14-9-5-3-6-10-14)22(27-2)28-16-13-23-21(29-18(16)19)15-11-7-4-8-12-15/h3-12,16-19,22H,13H2,1-2H3,(H,24,25)/t16?,17?,18-,19?,22?/m0/s1 |
| InChIKey | NGSCDLAFRPLQAD-VAHISZMNSA-N |
| XLogP | 2.02 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |