C17H29F3N6O10S — CID 159192913
(3R,4R,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-ol;[(3R,4S,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 159192913) has the molecular formula C17H29F3N6O10S and a molecular weight of 566.51 g/mol. Its IUPAC name is (3R,4R,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-ol;[(3R,4S,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | (3R,4R,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-ol;[(3R,4S,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159192913 |
| Molecular Formula | C17H29F3N6O10S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | (3R,4R,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-ol;[(3R,4S,5R)-5-(azidomethyl)-4-ethoxy-2-methoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CCO[C@H]1[C@@H](CN=[N+]=[N-])OC(OC)[C@@H]1O.CCO[C@H]1[C@@H](CN=[N+]=[N-])OC(OC)[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N3O6S.C8H15N3O4/c1-3-19-6-5(4-14-15-13)20-8(18-2)7(6)21-22(16,17)9(10,11)12;1-3-14-7-5(4-10-11-9)15-8(13-2)6(7)12/h5-8H,3-4H2,1-2H3;5-8,12H,3-4H2,1-2H3/t5-,6+,7-,8?;5-,6-,7+,8?/m11/s1 |
| InChIKey | KOHVEDZYNSJNOF-KRNWLTGKSA-N |
| XLogP | 1.74 |
| TPSA | 216.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|