C14H15N3O4 — CID 134865110
[6-(azidomethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-yl] benzoate (PubChem CID 134865110) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is [6-(azidomethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-yl] benzoate.
| Compound Name | [6-(azidomethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-yl] benzoate |
|---|---|
| PubChem CID | 134865110 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [6-(azidomethyl)-2-methoxy-3,6-dihydro-2H-pyran-3-yl] benzoate |
| SMILES | COC1OC(CN=[N+]=[N-])C=CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O4/c1-19-14-12(8-7-11(20-14)9-16-17-15)21-13(18)10-5-3-2-4-6-10/h2-8,11-12,14H,9H2,1H3 |
| InChIKey | HYFNCRJDIJEWDD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|