C23H38O5S — CID 102242685
(2R,3R,4S,5R,6S)-5-methoxy-4-pentoxy-2-(pentoxymethyl)-6-phenylsulfanyloxan-3-ol (PubChem CID 102242685) has the molecular formula C23H38O5S and a molecular weight of 426.62 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-5-methoxy-4-pentoxy-2-(pentoxymethyl)-6-phenylsulfanyloxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-5-methoxy-4-pentoxy-2-(pentoxymethyl)-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 102242685 |
| Molecular Formula | C23H38O5S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (2R,3R,4S,5R,6S)-5-methoxy-4-pentoxy-2-(pentoxymethyl)-6-phenylsulfanyloxan-3-ol |
| SMILES | CCCCCOC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC)[C@@H](OCCCCC)[C@@H]1O |
| InChI | InChI=1S/C23H38O5S/c1-4-6-11-15-26-17-19-20(24)21(27-16-12-7-5-2)22(25-3)23(28-19)29-18-13-9-8-10-14-18/h8-10,13-14,19-24H,4-7,11-12,15-17H2,1-3H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | MHHZFCBJAGCEHT-ZQGJOIPISA-N |
| XLogP | 4.66 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|