C30H40N4O6 — CID 118909386
[(3S,4S,6S)-5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 118909386) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is [(3S,4S,6S)-5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6S)-5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118909386 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | [(3S,4S,6S)-5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](OCCCCCN(Cc2ccccc2)C(=O)OCc2ccccc2)C(N=[N+]=[N-])[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C30H40N4O6/c1-22-23(2)28(32-33-31)29(40-27(22)21-38-24(3)35)37-18-12-6-11-17-34(19-25-13-7-4-8-14-25)30(36)39-20-26-15-9-5-10-16-26/h4-5,7-10,13-16,22-23,27-29H,6,11-12,17-21H2,1-3H3/t22-,23-,27?,28?,29-/m0/s1 |
| InChIKey | IYVLYJKRIXLDKR-NOPMEPNSSA-N |
| XLogP | 6.25 |
| TPSA | 123.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|