C36H46N2O6 — CID 161101458
benzyl N-[5-[(2R,4R,5S)-3-acetamido-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxypentyl]-N-benzylcarbamate (PubChem CID 161101458) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is benzyl N-[5-[(2R,4R,5S)-3-acetamido-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxypentyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[5-[(2R,4R,5S)-3-acetamido-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxypentyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 161101458 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | benzyl N-[5-[(2R,4R,5S)-3-acetamido-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxypentyl]-N-benzylcarbamate |
| SMILES | CC(=O)NC1[C@H](OCCCCCN(Cc2ccccc2)C(=O)OCc2ccccc2)OC(C)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C36H46N2O6/c1-27-33(37-29(3)39)35(44-28(2)34(27)42-25-31-18-10-5-11-19-31)41-23-15-7-14-22-38(24-30-16-8-4-9-17-30)36(40)43-26-32-20-12-6-13-21-32/h4-6,8-13,16-21,27-28,33-35H,7,14-15,22-26H2,1-3H3,(H,37,39)/t27-,28?,33?,34+,35-/m1/s1 |
| InChIKey | NTFZKSYFAZNHNV-KFFFKPHYSA-N |
| XLogP | 6.48 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|