C38H53NO11 — CID 158182072
methyl (3R,4R,6S)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-4-hydroxy-5-methyloxane-2-carboxylate (PubChem CID 158182072) has the molecular formula C38H53NO11 and a molecular weight of 699.84 g/mol. Its IUPAC name is methyl (3R,4R,6S)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-4-hydroxy-5-methyloxane-2-carboxylate.
| Compound Name | methyl (3R,4R,6S)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-4-hydroxy-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 158182072 |
| Molecular Formula | C38H53NO11 |
| Molecular Weight | 699.84 g/mol |
| Exact Mass | 699.36 |
| IUPAC Name | methyl (3R,4R,6S)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-4-hydroxy-5-methyloxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@H](OCCCCCN(Cc2ccccc2)C(=O)OCc2ccccc2)C(C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](C)C(C)C1OC(C)=O |
| InChI | InChI=1S/C38H53NO11/c1-24-25(2)32(48-28(5)40)37(47-27(24)4)49-33-31(41)26(3)36(50-34(33)35(42)44-6)45-21-15-9-14-20-39(22-29-16-10-7-11-17-29)38(43)46-23-30-18-12-8-13-19-30/h7-8,10-13,16-19,24-27,31-34,36-37,41H,9,14-15,20-23H2,1-6H3/t24-,25?,26?,27+,31-,32?,33-,34?,36+,37+/m1/s1 |
| InChIKey | MSINJNQDXXWKPW-GGKKLABGSA-N |
| XLogP | 5.24 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|