C34H39N3O5Si — CID 70996996
(3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-6-(naphthalen-2-ylmethoxy)oxan-4-ol (PubChem CID 70996996) has the molecular formula C34H39N3O5Si and a molecular weight of 597.79 g/mol. Its IUPAC name is (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-6-(naphthalen-2-ylmethoxy)oxan-4-ol.
| Compound Name | (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-6-(naphthalen-2-ylmethoxy)oxan-4-ol |
|---|---|
| PubChem CID | 70996996 |
| Molecular Formula | C34H39N3O5Si |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-6-(naphthalen-2-ylmethoxy)oxan-4-ol |
| SMILES | CO[C@@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(OCc2ccc3ccccc3c2)C(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C34H39N3O5Si/c1-34(2,3)43(27-15-7-5-8-16-27,28-17-9-6-10-18-28)41-23-29-32(39-4)31(38)30(36-37-35)33(42-29)40-22-24-19-20-25-13-11-12-14-26(25)21-24/h5-21,29-33,38H,22-23H2,1-4H3/t29?,30?,31-,32-,33?/m1/s1 |
| InChIKey | YZBBOHOMAWUMMH-FWYOVPOISA-N |
| XLogP | 5.71 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|