C20H25N3O4 — CID 58678969
(4R,5R)-3-azido-4,5-dimethoxy-2-methyl-6-(naphthalen-2-ylmethoxymethyl)oxane (PubChem CID 58678969) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (4R,5R)-3-azido-4,5-dimethoxy-2-methyl-6-(naphthalen-2-ylmethoxymethyl)oxane.
| Compound Name | (4R,5R)-3-azido-4,5-dimethoxy-2-methyl-6-(naphthalen-2-ylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 58678969 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (4R,5R)-3-azido-4,5-dimethoxy-2-methyl-6-(naphthalen-2-ylmethoxymethyl)oxane |
| SMILES | CO[C@@H]1C(N=[N+]=[N-])C(C)OC(COCc2ccc3ccccc3c2)[C@@H]1OC |
| InChI | InChI=1S/C20H25N3O4/c1-13-18(22-23-21)20(25-3)19(24-2)17(27-13)12-26-11-14-8-9-15-6-4-5-7-16(15)10-14/h4-10,13,17-20H,11-12H2,1-3H3/t13?,17?,18?,19-,20+/m0/s1 |
| InChIKey | ZYMVXKOAMZQOCQ-LFVKUFIWSA-N |
| XLogP | 3.85 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|