C40H46N4O6 — CID 140927638
benzyl 6-[(3R,4R,5R,6R)-3-azido-4-(2-deuterioprop-2-enoxy)-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxy-2-(benzylamino)hexanoate (PubChem CID 140927638) has the molecular formula C40H46N4O6 and a molecular weight of 679.84 g/mol. Its IUPAC name is benzyl 6-[(3R,4R,5R,6R)-3-azido-4-(2-deuterioprop-2-enoxy)-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxy-2-(benzylamino)hexanoate.
| Compound Name | benzyl 6-[(3R,4R,5R,6R)-3-azido-4-(2-deuterioprop-2-enoxy)-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxy-2-(benzylamino)hexanoate |
|---|---|
| PubChem CID | 140927638 |
| Molecular Formula | C40H46N4O6 |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.35 |
| IUPAC Name | benzyl 6-[(3R,4R,5R,6R)-3-azido-4-(2-deuterioprop-2-enoxy)-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxy-2-(benzylamino)hexanoate |
| SMILES | [2H]C(=C)CO[C@H]1[C@H](OCc2ccc3ccccc3c2)[C@@H](C)OC(OCCCCC(NCc2ccccc2)C(=O)OCc2ccccc2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C40H46N4O6/c1-3-23-46-38-36(43-44-41)40(50-29(2)37(38)48-28-32-21-22-33-18-10-11-19-34(33)25-32)47-24-13-12-20-35(42-26-30-14-6-4-7-15-30)39(45)49-27-31-16-8-5-9-17-31/h3-11,14-19,21-22,25,29,35-38,40,42H,1,12-13,20,23-24,26-28H2,2H3/t29-,35?,36-,37-,38-,40?/m1/s1/i3D |
| InChIKey | JKUJFCZTMUGHNR-XZXYYDCSSA-N |
| XLogP | 7.81 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|