C32H30N4O5 — CID 146027786
[(4S,5S)-5-azido-6-methanimidoyl-3-(naphthalen-2-ylmethoxy)-4-phenylmethoxyoxan-2-yl]methyl benzoate (PubChem CID 146027786) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is [(4S,5S)-5-azido-6-methanimidoyl-3-(naphthalen-2-ylmethoxy)-4-phenylmethoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(4S,5S)-5-azido-6-methanimidoyl-3-(naphthalen-2-ylmethoxy)-4-phenylmethoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 146027786 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [(4S,5S)-5-azido-6-methanimidoyl-3-(naphthalen-2-ylmethoxy)-4-phenylmethoxyoxan-2-yl]methyl benzoate |
| SMILES | [H]/N=C/C1OC(COC(=O)c2ccccc2)C(OCc2ccc3ccccc3c2)[C@@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C32H30N4O5/c33-18-27-29(35-36-34)31(39-19-22-9-3-1-4-10-22)30(28(41-27)21-40-32(37)25-12-5-2-6-13-25)38-20-23-15-16-24-11-7-8-14-26(24)17-23/h1-18,27-31,33H,19-21H2/b33-18+/t27?,28?,29-,30?,31-/m0/s1 |
| InChIKey | CDQTZJQEYFEZEZ-NBBBAESBSA-N |
| XLogP | 6.26 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|