C20H27N3O7 — CID 101091390
[(2S,3R,4R,5S)-4-acetyloxy-6-(3-azidopropoxy)-2-methyl-5-phenylmethoxyoxan-3-yl] acetate (PubChem CID 101091390) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4-acetyloxy-6-(3-azidopropoxy)-2-methyl-5-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4-acetyloxy-6-(3-azidopropoxy)-2-methyl-5-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 101091390 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [(2S,3R,4R,5S)-4-acetyloxy-6-(3-azidopropoxy)-2-methyl-5-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)OC(OCCCN=[N+]=[N-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H27N3O7/c1-13-17(29-14(2)24)18(30-15(3)25)19(27-12-16-8-5-4-6-9-16)20(28-13)26-11-7-10-22-23-21/h4-6,8-9,13,17-20H,7,10-12H2,1-3H3/t13-,17+,18+,19-,20?/m0/s1 |
| InChIKey | YVFVHPBQROMKKK-DPFUVYGKSA-N |
| XLogP | 2.90 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|