C26H31N3O8 — CID 126686286
[(4aR,6S,7S,8S,8aR)-6-(3-azidopropoxy)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 126686286) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is [(4aR,6S,7S,8S,8aR)-6-(3-azidopropoxy)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(4aR,6S,7S,8S,8aR)-6-(3-azidopropoxy)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 126686286 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [(4aR,6S,7S,8S,8aR)-6-(3-azidopropoxy)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | COc1ccc(CO[C@@H]2[C@H](OC(C)=O)[C@@H](OCCCN=[N+]=[N-])O[C@@H]3COC(c4ccccc4)O[C@@H]23)cc1 |
| InChI | InChI=1S/C26H31N3O8/c1-17(30)35-24-23(33-15-18-9-11-20(31-2)12-10-18)22-21(36-26(24)32-14-6-13-28-29-27)16-34-25(37-22)19-7-4-3-5-8-19/h3-5,7-12,21-26H,6,13-16H2,1-2H3/t21-,22-,23+,24+,25?,26+/m1/s1 |
| InChIKey | DGFRLBRMQPRZNE-KIWPLCOFSA-N |
| XLogP | 4.07 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|