C44H48F2IN5O8 — CID 167633562
benzyl N-[(1S)-1-[(2S)-5-azido-6-oxooxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate;benzyl N-benzyl-N-[(1S)-2-fluoro-1-[(2S)-6-hydroxy-5-iodooxan-2-yl]ethyl]carbamate (PubChem CID 167633562) has the molecular formula C44H48F2IN5O8 and a molecular weight of 939.79 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S)-5-azido-6-oxooxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate;benzyl N-benzyl-N-[(1S)-2-fluoro-1-[(2S)-6-hydroxy-5-iodooxan-2-yl]ethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[(2S)-5-azido-6-oxooxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate;benzyl N-benzyl-N-[(1S)-2-fluoro-1-[(2S)-6-hydroxy-5-iodooxan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 167633562 |
| Molecular Formula | C44H48F2IN5O8 |
| Molecular Weight | 939.79 g/mol |
| Exact Mass | 939.25 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S)-5-azido-6-oxooxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate;benzyl N-benzyl-N-[(1S)-2-fluoro-1-[(2S)-6-hydroxy-5-iodooxan-2-yl]ethyl]carbamate |
| SMILES | O=C(OCc1ccccc1)N(Cc1ccccc1)[C@H](CF)[C@@H]1CCC(I)C(O)O1.[N-]=[N+]=NC1CC[C@@H]([C@@H](CF)N(Cc2ccccc2)C(=O)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C22H25FINO4.C22H23FN4O4/c23-13-19(20-12-11-18(24)21(26)29-20)25(14-16-7-3-1-4-8-16)22(27)28-15-17-9-5-2-6-10-17;23-13-19(20-12-11-18(25-26-24)21(28)31-20)27(14-16-7-3-1-4-8-16)22(29)30-15-17-9-5-2-6-10-17/h1-10,18-21,26H,11-15H2;1-10,18-20H,11-15H2/t18?,19-,20+,21?;18?,19-,20+/m11/s1 |
| InChIKey | ODOOJUXVIFPTTN-AUAMEDPZSA-N |
| XLogP | 9.01 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.79 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|