C23H28INO3 — CID 167610983
benzyl N-benzyl-N-[(1R)-1-[(2S)-5-iodo-6-methyloxan-2-yl]ethyl]carbamate (PubChem CID 167610983) has the molecular formula C23H28INO3 and a molecular weight of 493.39 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(1R)-1-[(2S)-5-iodo-6-methyloxan-2-yl]ethyl]carbamate.
| Compound Name | benzyl N-benzyl-N-[(1R)-1-[(2S)-5-iodo-6-methyloxan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 167610983 |
| Molecular Formula | C23H28INO3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | benzyl N-benzyl-N-[(1R)-1-[(2S)-5-iodo-6-methyloxan-2-yl]ethyl]carbamate |
| SMILES | CC1O[C@H]([C@@H](C)N(Cc2ccccc2)C(=O)OCc2ccccc2)CCC1I |
| InChI | InChI=1S/C23H28INO3/c1-17(22-14-13-21(24)18(2)28-22)25(15-19-9-5-3-6-10-19)23(26)27-16-20-11-7-4-8-12-20/h3-12,17-18,21-22H,13-16H2,1-2H3/t17-,18?,21?,22+/m1/s1 |
| InChIKey | IPHSBUCJCDIPDK-KDFVNGPGSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|