C13H18N2O3 — CID 172684690
benzyl N-amino-N-[(2S,3S)-2-methyloxolan-3-yl]carbamate (PubChem CID 172684690) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is benzyl N-amino-N-[(2S,3S)-2-methyloxolan-3-yl]carbamate.
| Compound Name | benzyl N-amino-N-[(2S,3S)-2-methyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 172684690 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | benzyl N-amino-N-[(2S,3S)-2-methyloxolan-3-yl]carbamate |
| SMILES | C[C@@H]1OCC[C@@H]1N(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-10-12(7-8-17-10)15(14)13(16)18-9-11-5-3-2-4-6-11/h2-6,10,12H,7-9,14H2,1H3/t10-,12-/m0/s1 |
| InChIKey | AWKSEWVQYIVDKM-JQWIXIFHSA-N |
| XLogP | 1.68 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|