C18H26N2O2 — CID 142021413
benzyl N-(2-methylcyclopropyl)-N-(1-methylpiperidin-4-yl)carbamate (PubChem CID 142021413) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is benzyl N-(2-methylcyclopropyl)-N-(1-methylpiperidin-4-yl)carbamate.
| Compound Name | benzyl N-(2-methylcyclopropyl)-N-(1-methylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 142021413 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | benzyl N-(2-methylcyclopropyl)-N-(1-methylpiperidin-4-yl)carbamate |
| SMILES | CC1CC1N(C(=O)OCc1ccccc1)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-14-12-17(14)20(16-8-10-19(2)11-9-16)18(21)22-13-15-6-4-3-5-7-15/h3-7,14,16-17H,8-13H2,1-2H3 |
| InChIKey | OZZTWLDCPAVWMU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |