C17H21N5O3 — CID 139796796
1-[(2R,4S,5R)-5-(azidomethyl)-4-phenylmethoxyoxolan-2-yl]-4-methoxy-2H-pyrimidine (PubChem CID 139796796) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(azidomethyl)-4-phenylmethoxyoxolan-2-yl]-4-methoxy-2H-pyrimidine.
| Compound Name | 1-[(2R,4S,5R)-5-(azidomethyl)-4-phenylmethoxyoxolan-2-yl]-4-methoxy-2H-pyrimidine |
|---|---|
| PubChem CID | 139796796 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(azidomethyl)-4-phenylmethoxyoxolan-2-yl]-4-methoxy-2H-pyrimidine |
| SMILES | COC1=NCN([C@H]2C[C@H](OCc3ccccc3)[C@@H](CN=[N+]=[N-])O2)C=C1 |
| InChI | InChI=1S/C17H21N5O3/c1-23-16-7-8-22(12-19-16)17-9-14(15(25-17)10-20-21-18)24-11-13-5-3-2-4-6-13/h2-8,14-15,17H,9-12H2,1H3/t14-,15+,17+/m0/s1 |
| InChIKey | RTKDSDNTAGVHTK-ZMSDIMECSA-N |
| XLogP | 2.83 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|