C16H18O4 — CID 102304362
[(2R,3S,6S)-3-phenylmethoxy-6-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 102304362) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(2R,3S,6S)-3-phenylmethoxy-6-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [(2R,3S,6S)-3-phenylmethoxy-6-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 102304362 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(2R,3S,6S)-3-phenylmethoxy-6-prop-2-ynoxy-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | C#CCO[C@@H]1C=C[C@H](OCc2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H18O4/c1-2-10-18-16-9-8-14(15(11-17)20-16)19-12-13-6-4-3-5-7-13/h1,3-9,14-17H,10-12H2/t14-,15+,16-/m0/s1 |
| InChIKey | WUSBULXXWGZIKT-XHSDSOJGSA-N |
| XLogP | 1.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|