C24H40O2Si — CID 71527283
tert-butyl-[(2R)-2-[(1S,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]-2-phenylmethoxyethoxy]-dimethylsilane (PubChem CID 71527283) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(1S,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]-2-phenylmethoxyethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(1S,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]-2-phenylmethoxyethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71527283 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | tert-butyl-[(2R)-2-[(1S,3S)-2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl]-2-phenylmethoxyethoxy]-dimethylsilane |
| SMILES | C=C(C)[C@@H]1C[C@H]([C@H](CO[Si](C)(C)C(C)(C)C)OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C24H40O2Si/c1-18(2)20-15-21(24(20,6)7)22(17-26-27(8,9)23(3,4)5)25-16-19-13-11-10-12-14-19/h10-14,20-22H,1,15-17H2,2-9H3/t20-,21+,22-/m0/s1 |
| InChIKey | SPXILWKEUYRXTM-BDTNDASRSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|