C44H54O3Si2 — CID 54131123
tert-butyl-[3-[tert-butyl(diphenyl)silyl]oxy-5-ethylidene-4-methylidene-2-prop-2-enoxycyclohexyl]oxy-diphenylsilane (PubChem CID 54131123) has the molecular formula C44H54O3Si2 and a molecular weight of 687.09 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(diphenyl)silyl]oxy-5-ethylidene-4-methylidene-2-prop-2-enoxycyclohexyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[3-[tert-butyl(diphenyl)silyl]oxy-5-ethylidene-4-methylidene-2-prop-2-enoxycyclohexyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 54131123 |
| Molecular Formula | C44H54O3Si2 |
| Molecular Weight | 687.09 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(diphenyl)silyl]oxy-5-ethylidene-4-methylidene-2-prop-2-enoxycyclohexyl]oxy-diphenylsilane |
| SMILES | C=CCOC1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=CC)C(=C)C1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H54O3Si2/c1-10-32-45-42-40(46-48(43(4,5)6,36-24-16-12-17-25-36)37-26-18-13-19-27-37)33-35(11-2)34(3)41(42)47-49(44(7,8)9,38-28-20-14-21-29-38)39-30-22-15-23-31-39/h10-31,40-42H,1,3,32-33H2,2,4-9H3 |
| InChIKey | OWMIFQLWAMJBJJ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.09 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|