C21H23O3PS2 — CID 18736950
[[(2Z)-2-[2-methylidene-3,5-bis(sulfanyloxy)cyclohexylidene]ethyl]-phenylphosphoryl]benzene (PubChem CID 18736950) has the molecular formula C21H23O3PS2 and a molecular weight of 418.52 g/mol. Its IUPAC name is [[(2Z)-2-[2-methylidene-3,5-bis(sulfanyloxy)cyclohexylidene]ethyl]-phenylphosphoryl]benzene.
| Compound Name | [[(2Z)-2-[2-methylidene-3,5-bis(sulfanyloxy)cyclohexylidene]ethyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 18736950 |
| Molecular Formula | C21H23O3PS2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [[(2Z)-2-[2-methylidene-3,5-bis(sulfanyloxy)cyclohexylidene]ethyl]-phenylphosphoryl]benzene |
| SMILES | C=C1/C(=C\CP(=O)(c2ccccc2)c2ccccc2)CC(OS)CC1OS |
| InChI | InChI=1S/C21H23O3PS2/c1-16-17(14-18(23-26)15-21(16)24-27)12-13-25(22,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-12,18,21,26-27H,1,13-15H2/b17-12- |
| InChIKey | LOIUBIGAQQAWCX-ATVHPVEESA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|