C21H23OP — CID 143809980
[2-(4-methylidenecyclohexylidene)ethyl-phenylphosphoryl]benzene (PubChem CID 143809980) has the molecular formula C21H23OP and a molecular weight of 322.39 g/mol. Its IUPAC name is [2-(4-methylidenecyclohexylidene)ethyl-phenylphosphoryl]benzene.
| Compound Name | [2-(4-methylidenecyclohexylidene)ethyl-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 143809980 |
| Molecular Formula | C21H23OP |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-(4-methylidenecyclohexylidene)ethyl-phenylphosphoryl]benzene |
| SMILES | C=C1CCC(=CCP(=O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23OP/c1-18-12-14-19(15-13-18)16-17-23(22,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,16H,1,12-15,17H2 |
| InChIKey | JAEJQMZHYYBCSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|