C21H22FO2P — CID 89187765
cis-(1R,3S,5Z)-5-(2-diphenylphosphorylethylidene)-3-fluoro-2-methylidenecyclohexan-1-ol (PubChem CID 89187765) has the molecular formula C21H22FO2P and a molecular weight of 356.38 g/mol. Its IUPAC name is cis-(1R,3S,5Z)-5-(2-diphenylphosphorylethylidene)-3-fluoro-2-methylidenecyclohexan-1-ol.
| Compound Name | cis-(1R,3S,5Z)-5-(2-diphenylphosphorylethylidene)-3-fluoro-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 89187765 |
| Molecular Formula | C21H22FO2P |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | cis-(1R,3S,5Z)-5-(2-diphenylphosphorylethylidene)-3-fluoro-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1[C@H](O)C/C(=C/CP(=O)(c2ccccc2)c2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C21H22FO2P/c1-16-20(22)14-17(15-21(16)23)12-13-25(24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-12,20-21,23H,1,13-15H2/b17-12+/t20-,21+/m0/s1 |
| InChIKey | FPDPATYOLXXKJR-WJTFXVHJSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|