C14H31NO3Si — CID 16657977
(2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-ol (PubChem CID 16657977) has the molecular formula C14H31NO3Si and a molecular weight of 289.49 g/mol. Its IUPAC name is (2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-ol.
| Compound Name | (2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-ol |
|---|---|
| PubChem CID | 16657977 |
| Molecular Formula | C14H31NO3Si |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | (2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-ol |
| SMILES | C[C@@H]1O[C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1N(C)C |
| InChI | InChI=1S/C14H31NO3Si/c1-10-13(15(5)6)11(9-12(16)17-10)18-19(7,8)14(2,3)4/h10-13,16H,9H2,1-8H3/t10-,11-,12+,13+/m0/s1 |
| InChIKey | ONQKFMRFTCRJQY-WUHRBBMRSA-N |
| XLogP | 2.43 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|