C28H53NO5Si2 — CID 102082611
(2R,3R)-2-[(2S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-yl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-1,3-diol (PubChem CID 102082611) has the molecular formula C28H53NO5Si2 and a molecular weight of 539.91 g/mol. Its IUPAC name is (2R,3R)-2-[(2S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-yl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-1,3-diol.
| Compound Name | (2R,3R)-2-[(2S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-yl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-1,3-diol |
|---|---|
| PubChem CID | 102082611 |
| Molecular Formula | C28H53NO5Si2 |
| Molecular Weight | 539.91 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | (2R,3R)-2-[(2S,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(dimethylamino)-6-methyloxan-2-yl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-1,3-diol |
| SMILES | C#C[C@](O)(CC#C[Si](CC)(CC)CC)[C@@H](CO)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](N(C)C)[C@H](C)O1 |
| InChI | InChI=1S/C28H53NO5Si2/c1-13-28(31,18-17-19-36(14-2,15-3)16-4)24(21-30)33-25-20-23(26(29(9)10)22(5)32-25)34-35(11,12)27(6,7)8/h1,22-26,30-31H,14-16,18,20-21H2,2-12H3/t22-,23-,24+,25-,26+,28-/m0/s1 |
| InChIKey | HXWVSPFQTLLJMX-APSJSYONSA-N |
| XLogP | 4.62 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|