C9H10ClFN4O4 — CID 118280713
2-(5-chloro-4-nitropyrazol-1-yl)-5-fluoropiperidine-1-carboxylic acid (PubChem CID 118280713) has the molecular formula C9H10ClFN4O4 and a molecular weight of 292.65 g/mol. Its IUPAC name is 2-(5-chloro-4-nitropyrazol-1-yl)-5-fluoropiperidine-1-carboxylic acid.
| Compound Name | 2-(5-chloro-4-nitropyrazol-1-yl)-5-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118280713 |
| Molecular Formula | C9H10ClFN4O4 |
| Molecular Weight | 292.65 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-(5-chloro-4-nitropyrazol-1-yl)-5-fluoropiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(F)CCC1n1ncc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C9H10ClFN4O4/c10-8-6(15(18)19)3-12-14(8)7-2-1-5(11)4-13(7)9(16)17/h3,5,7H,1-2,4H2,(H,16,17) |
| InChIKey | QYZUMUULAZAIMG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|