About 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine
3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine (PubChem CID 118288910) has the molecular formula C8H9ClF2N4O2
and a molecular weight of 266.63 g/mol. Its IUPAC name is 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine |
| PubChem CID | 118288910 |
| Molecular Formula | C8H9ClF2N4O2 |
| Molecular Weight | 266.63 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine |
| SMILES | O=[N+]([O-])c1cnn(C2CNCCC2(F)F)c1Cl |
| InChI | InChI=1S/C8H9ClF2N4O2/c9-7-5(15(16)17)3-13-14(7)6-4-12-2-1-8(6,10)11/h3,6,12H,1-2,4H2 |
| InChIKey | WHLQRAUHORHKIU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine?
The IUPAC name of 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine (CID 118288910) is 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine.
What is the SMILES notation for 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine?
The canonical SMILES for 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine is O=[N+]([O-])c1cnn(C2CNCCC2(F)F)c1Cl.
What is the InChIKey of 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine?
The InChIKey is WHLQRAUHORHKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF2N4O2/c9-7-5(15(16)17)3-13-14(7)6-4-12-2-1-8(6,10)11/h3,6,12H,1-2,4H2.
What are the key properties of 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine?
3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine has a molecular weight of 266.63 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine is sourced from PubChem (CID 118288910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).