C8H9ClF2N4O2 — CID 118288910
3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine (PubChem CID 118288910) has the molecular formula C8H9ClF2N4O2 and a molecular weight of 266.63 g/mol. Its IUPAC name is 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine.
| Compound Name | 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 118288910 |
| Molecular Formula | C8H9ClF2N4O2 |
| Molecular Weight | 266.63 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(5-chloro-4-nitropyrazol-1-yl)-4,4-difluoropiperidine |
| SMILES | O=[N+]([O-])c1cnn(C2CNCCC2(F)F)c1Cl |
| InChI | InChI=1S/C8H9ClF2N4O2/c9-7-5(15(16)17)3-13-14(7)6-4-12-2-1-8(6,10)11/h3,6,12H,1-2,4H2 |
| InChIKey | WHLQRAUHORHKIU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|