C8H10F2N4O2 — CID 144894585
4,4-difluoro-3-(4-nitropyrazol-1-yl)piperidine (PubChem CID 144894585) has the molecular formula C8H10F2N4O2 and a molecular weight of 232.19 g/mol. Its IUPAC name is 4,4-difluoro-3-(4-nitropyrazol-1-yl)piperidine.
| Compound Name | 4,4-difluoro-3-(4-nitropyrazol-1-yl)piperidine |
|---|---|
| PubChem CID | 144894585 |
| Molecular Formula | C8H10F2N4O2 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4,4-difluoro-3-(4-nitropyrazol-1-yl)piperidine |
| SMILES | O=[N+]([O-])c1cnn(C2CNCCC2(F)F)c1 |
| InChI | InChI=1S/C8H10F2N4O2/c9-8(10)1-2-11-4-7(8)13-5-6(3-12-13)14(15)16/h3,5,7,11H,1-2,4H2 |
| InChIKey | ISTNJCJNRXIOBC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|