C14H22N4O4 — CID 174819617
[3-methyl-4-(4-nitropyrazol-1-yl)piperidin-3-yl] 2,2-dimethylpropanoate (PubChem CID 174819617) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is [3-methyl-4-(4-nitropyrazol-1-yl)piperidin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-methyl-4-(4-nitropyrazol-1-yl)piperidin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174819617 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [3-methyl-4-(4-nitropyrazol-1-yl)piperidin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1(C)CNCCC1n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H22N4O4/c1-13(2,3)12(19)22-14(4)9-15-6-5-11(14)17-8-10(7-16-17)18(20)21/h7-8,11,15H,5-6,9H2,1-4H3 |
| InChIKey | IYYPPVFDCRLLNY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|