C12H11N3O2 — CID 153285823
1-(2,3-dihydro-1H-inden-1-yl)-4-nitropyrazole (PubChem CID 153285823) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-4-nitropyrazole.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-4-nitropyrazole |
|---|---|
| PubChem CID | 153285823 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-4-nitropyrazole |
| SMILES | O=[N+]([O-])c1cnn(C2CCc3ccccc32)c1 |
| InChI | InChI=1S/C12H11N3O2/c16-15(17)10-7-13-14(8-10)12-6-5-9-3-1-2-4-11(9)12/h1-4,7-8,12H,5-6H2 |
| InChIKey | NSJGHKBENFGWCU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|