C18H24N4O3 — CID 111799426
3-[2-(4-nitropyrazol-1-yl)ethyl-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]propan-1-ol (PubChem CID 111799426) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[2-(4-nitropyrazol-1-yl)ethyl-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]propan-1-ol.
| Compound Name | 3-[2-(4-nitropyrazol-1-yl)ethyl-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 111799426 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[2-(4-nitropyrazol-1-yl)ethyl-(1,2,3,4-tetrahydronaphthalen-1-yl)amino]propan-1-ol |
| SMILES | O=[N+]([O-])c1cnn(CCN(CCCO)C2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C18H24N4O3/c23-12-4-9-20(10-11-21-14-16(13-19-21)22(24)25)18-8-3-6-15-5-1-2-7-17(15)18/h1-2,5,7,13-14,18,23H,3-4,6,8-12H2 |
| InChIKey | AGJMNGBKKZGDBD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|