C11H15F3N4O2 — CID 175357938
4-(4-nitropyrazol-1-yl)-1-(2,3,3-trifluoropropyl)piperidine (PubChem CID 175357938) has the molecular formula C11H15F3N4O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-(4-nitropyrazol-1-yl)-1-(2,3,3-trifluoropropyl)piperidine.
| Compound Name | 4-(4-nitropyrazol-1-yl)-1-(2,3,3-trifluoropropyl)piperidine |
|---|---|
| PubChem CID | 175357938 |
| Molecular Formula | C11H15F3N4O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(4-nitropyrazol-1-yl)-1-(2,3,3-trifluoropropyl)piperidine |
| SMILES | O=[N+]([O-])c1cnn(C2CCN(CC(F)C(F)F)CC2)c1 |
| InChI | InChI=1S/C11H15F3N4O2/c12-10(11(13)14)7-16-3-1-8(2-4-16)17-6-9(5-15-17)18(19)20/h5-6,8,10-11H,1-4,7H2 |
| InChIKey | ANZVCTVBNAAKBZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|