C17H20F2N4O2 — CID 118280676
(2R)-2-(difluoromethyl)-4-(4-nitropyrazol-1-yl)-1-[(1R)-1-phenylethyl]piperidine (PubChem CID 118280676) has the molecular formula C17H20F2N4O2 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2R)-2-(difluoromethyl)-4-(4-nitropyrazol-1-yl)-1-[(1R)-1-phenylethyl]piperidine.
| Compound Name | (2R)-2-(difluoromethyl)-4-(4-nitropyrazol-1-yl)-1-[(1R)-1-phenylethyl]piperidine |
|---|---|
| PubChem CID | 118280676 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2R)-2-(difluoromethyl)-4-(4-nitropyrazol-1-yl)-1-[(1R)-1-phenylethyl]piperidine |
| SMILES | C[C@H](c1ccccc1)N1CCC(n2cc([N+](=O)[O-])cn2)C[C@@H]1C(F)F |
| InChI | InChI=1S/C17H20F2N4O2/c1-12(13-5-3-2-4-6-13)21-8-7-14(9-16(21)17(18)19)22-11-15(10-20-22)23(24)25/h2-6,10-12,14,16-17H,7-9H2,1H3/t12-,14?,16-/m1/s1 |
| InChIKey | DFLULGFTDCBIAC-QXDOLYAVSA-N |
| XLogP | 3.82 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|