C15H21F2NO3S — CID 118288847
[(2R)-2-(difluoromethyl)-1-[(1R)-1-phenylethyl]piperidin-4-yl] methanesulfonate (PubChem CID 118288847) has the molecular formula C15H21F2NO3S and a molecular weight of 333.40 g/mol. Its IUPAC name is [(2R)-2-(difluoromethyl)-1-[(1R)-1-phenylethyl]piperidin-4-yl] methanesulfonate.
| Compound Name | [(2R)-2-(difluoromethyl)-1-[(1R)-1-phenylethyl]piperidin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 118288847 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [(2R)-2-(difluoromethyl)-1-[(1R)-1-phenylethyl]piperidin-4-yl] methanesulfonate |
| SMILES | C[C@H](c1ccccc1)N1CCC(OS(C)(=O)=O)C[C@@H]1C(F)F |
| InChI | InChI=1S/C15H21F2NO3S/c1-11(12-6-4-3-5-7-12)18-9-8-13(21-22(2,19)20)10-14(18)15(16)17/h3-7,11,13-15H,8-10H2,1-2H3/t11-,13?,14-/m1/s1 |
| InChIKey | HUJPTNAFWUSHKR-AODWJNRKSA-N |
| XLogP | 2.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|