C12H18N4O3 — CID 162748013
(3R,4S)-3-methyl-4-(4-nitropyrazol-1-yl)-1-(oxetan-3-yl)piperidine (PubChem CID 162748013) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (3R,4S)-3-methyl-4-(4-nitropyrazol-1-yl)-1-(oxetan-3-yl)piperidine.
| Compound Name | (3R,4S)-3-methyl-4-(4-nitropyrazol-1-yl)-1-(oxetan-3-yl)piperidine |
|---|---|
| PubChem CID | 162748013 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (3R,4S)-3-methyl-4-(4-nitropyrazol-1-yl)-1-(oxetan-3-yl)piperidine |
| SMILES | C[C@@H]1CN(C2COC2)CC[C@@H]1n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H18N4O3/c1-9-5-14(11-7-19-8-11)3-2-12(9)15-6-10(4-13-15)16(17)18/h4,6,9,11-12H,2-3,5,7-8H2,1H3/t9-,12+/m1/s1 |
| InChIKey | WWUVOTQCADYKJB-SKDRFNHKSA-N |
| XLogP | 1.07 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|