C13H15ClN4O3 — CID 162748203
(3R,4S)-4-(5-chloro-4-nitropyrazol-1-yl)-3-ethynyl-1-(oxetan-3-yl)piperidine (PubChem CID 162748203) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is (3R,4S)-4-(5-chloro-4-nitropyrazol-1-yl)-3-ethynyl-1-(oxetan-3-yl)piperidine.
| Compound Name | (3R,4S)-4-(5-chloro-4-nitropyrazol-1-yl)-3-ethynyl-1-(oxetan-3-yl)piperidine |
|---|---|
| PubChem CID | 162748203 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (3R,4S)-4-(5-chloro-4-nitropyrazol-1-yl)-3-ethynyl-1-(oxetan-3-yl)piperidine |
| SMILES | C#C[C@@H]1CN(C2COC2)CC[C@@H]1n1ncc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C13H15ClN4O3/c1-2-9-6-16(10-7-21-8-10)4-3-11(9)17-13(14)12(5-15-17)18(19)20/h1,5,9-11H,3-4,6-8H2/t9-,11+/m1/s1 |
| InChIKey | KAQABWGAVDXQSK-KOLCDFICSA-N |
| XLogP | 1.34 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|