C13H19F2N5O3 — CID 122141416
N-[[1-(2,2-difluoroethyl)piperidin-4-yl]methyl]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 122141416) has the molecular formula C13H19F2N5O3 and a molecular weight of 331.32 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethyl)piperidin-4-yl]methyl]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[[1-(2,2-difluoroethyl)piperidin-4-yl]methyl]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 122141416 |
| Molecular Formula | C13H19F2N5O3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[[1-(2,2-difluoroethyl)piperidin-4-yl]methyl]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)NCC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C13H19F2N5O3/c14-12(15)8-18-3-1-10(2-4-18)5-16-13(21)9-19-7-11(6-17-19)20(22)23/h6-7,10,12H,1-5,8-9H2,(H,16,21) |
| InChIKey | UKMSFFNHFJQFNT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|