C22H38N4O3 — CID 100684358
tert-butyl (3S)-3-[4-[pentyl(propan-2-yl)carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 100684358) has the molecular formula C22H38N4O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-[pentyl(propan-2-yl)carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[4-[pentyl(propan-2-yl)carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100684358 |
| Molecular Formula | C22H38N4O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | tert-butyl (3S)-3-[4-[pentyl(propan-2-yl)carbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCCCCN(C(=O)c1cnn([C@H]2CCCN(C(=O)OC(C)(C)C)C2)c1)C(C)C |
| InChI | InChI=1S/C22H38N4O3/c1-7-8-9-13-25(17(2)3)20(27)18-14-23-26(15-18)19-11-10-12-24(16-19)21(28)29-22(4,5)6/h14-15,17,19H,7-13,16H2,1-6H3/t19-/m0/s1 |
| InChIKey | MJPHOAKRXJEGGF-IBGZPJMESA-N |
| XLogP | 4.50 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|