C17H22BrN3O3 — CID 170559824
tert-butyl (3S)-3-[5-bromo-3-(hydroxymethyl)indazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 170559824) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-bromo-3-(hydroxymethyl)indazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[5-bromo-3-(hydroxymethyl)indazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170559824 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | tert-butyl (3S)-3-[5-bromo-3-(hydroxymethyl)indazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2nc(CO)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C17H22BrN3O3/c1-17(2,3)24-16(23)20-7-6-12(9-20)21-15-5-4-11(18)8-13(15)14(10-22)19-21/h4-5,8,12,22H,6-7,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | UDMODOYCIJJYRC-LBPRGKRZSA-N |
| XLogP | 3.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |