C18H21BrN2O4 — CID 90985024
tert-butyl 3-(7-bromo-1-hydroxy-3-oxoisoquinolin-2-yl)pyrrolidine-1-carboxylate (PubChem CID 90985024) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is tert-butyl 3-(7-bromo-1-hydroxy-3-oxoisoquinolin-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(7-bromo-1-hydroxy-3-oxoisoquinolin-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90985024 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | tert-butyl 3-(7-bromo-1-hydroxy-3-oxoisoquinolin-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(O)c3cc(Br)ccc3cc2=O)C1 |
| InChI | InChI=1S/C18H21BrN2O4/c1-18(2,3)25-17(24)20-7-6-13(10-20)21-15(22)8-11-4-5-12(19)9-14(11)16(21)23/h4-5,8-9,13,23H,6-7,10H2,1-3H3 |
| InChIKey | NFXWQULZIMQXLE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |