C20H28BrN3O3 — CID 71650694
tert-butyl 4-[3-(3-bromopropyl)-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate (PubChem CID 71650694) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is tert-butyl 4-[3-(3-bromopropyl)-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(3-bromopropyl)-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71650694 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | tert-butyl 4-[3-(3-bromopropyl)-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(=O)n(CCCBr)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H28BrN3O3/c1-20(2,3)27-19(26)22-13-9-15(10-14-22)24-17-8-5-4-7-16(17)23(18(24)25)12-6-11-21/h4-5,7-8,15H,6,9-14H2,1-3H3 |
| InChIKey | BDIZDNIBVFPUFT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|