C19H26N4O4 — CID 163381687
tert-butyl 4-(1,6-dimethyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidine-1-carboxylate (PubChem CID 163381687) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl 4-(1,6-dimethyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,6-dimethyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163381687 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | tert-butyl 4-(1,6-dimethyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)piperidine-1-carboxylate |
| SMILES | Cc1ccc2c(n1)n(C1CCN(C(=O)OC(C)(C)C)CC1)c(=O)c(=O)n2C |
| InChI | InChI=1S/C19H26N4O4/c1-12-6-7-14-15(20-12)23(17(25)16(24)21(14)5)13-8-10-22(11-9-13)18(26)27-19(2,3)4/h6-7,13H,8-11H2,1-5H3 |
| InChIKey | LAVZRISSTXDZRG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|