C27H34N2O4 — CID 159543159
tert-butyl N-[3-(5-methoxyindol-1-yl)propyl]carbamate;5-methoxy-1H-indene (PubChem CID 159543159) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl N-[3-(5-methoxyindol-1-yl)propyl]carbamate;5-methoxy-1H-indene.
| Compound Name | tert-butyl N-[3-(5-methoxyindol-1-yl)propyl]carbamate;5-methoxy-1H-indene |
|---|---|
| PubChem CID | 159543159 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl N-[3-(5-methoxyindol-1-yl)propyl]carbamate;5-methoxy-1H-indene |
| SMILES | COc1ccc2c(c1)C=CC2.COc1ccc2c(ccn2CCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N2O3.C10H10O/c1-17(2,3)22-16(20)18-9-5-10-19-11-8-13-12-14(21-4)6-7-15(13)19;1-11-10-6-5-8-3-2-4-9(8)7-10/h6-8,11-12H,5,9-10H2,1-4H3,(H,18,20);2,4-7H,3H2,1H3 |
| InChIKey | MELWHLZEERTXRJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|